5-[5-({cyclopropyl[(2-methylphenyl)methyl]amino}methyl)furan-2-yl]nona-1,8-dien-5-ol
Chemical Structure Depiction of
5-[5-({cyclopropyl[(2-methylphenyl)methyl]amino}methyl)furan-2-yl]nona-1,8-dien-5-ol
5-[5-({cyclopropyl[(2-methylphenyl)methyl]amino}methyl)furan-2-yl]nona-1,8-dien-5-ol
Compound characteristics
| Compound ID: | V022-0499 |
| Compound Name: | 5-[5-({cyclopropyl[(2-methylphenyl)methyl]amino}methyl)furan-2-yl]nona-1,8-dien-5-ol |
| Molecular Weight: | 379.54 |
| Molecular Formula: | C25 H33 N O2 |
| Salt: | not_available |
| Smiles: | Cc1ccccc1CN(Cc1ccc(C(CCC=C)(CCC=C)O)o1)C1CC1 |
| Stereo: | ACHIRAL |
| logP: | 6.5629 |
| logD: | 5.3211 |
| logSw: | -5.8509 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 26.9904 |
| InChI Key: | WUWVEDSEXSSEER-UHFFFAOYSA-N |