2-methylpropyl 1-[(4-bromophenyl)methyl]-2-methyl-6-oxo-4-[4-(trifluoromethyl)phenyl]-1,4,5,6-tetrahydropyridine-3-carboxylate
Chemical Structure Depiction of
2-methylpropyl 1-[(4-bromophenyl)methyl]-2-methyl-6-oxo-4-[4-(trifluoromethyl)phenyl]-1,4,5,6-tetrahydropyridine-3-carboxylate
2-methylpropyl 1-[(4-bromophenyl)methyl]-2-methyl-6-oxo-4-[4-(trifluoromethyl)phenyl]-1,4,5,6-tetrahydropyridine-3-carboxylate
Compound characteristics
| Compound ID: | V022-4526 |
| Compound Name: | 2-methylpropyl 1-[(4-bromophenyl)methyl]-2-methyl-6-oxo-4-[4-(trifluoromethyl)phenyl]-1,4,5,6-tetrahydropyridine-3-carboxylate |
| Molecular Weight: | 524.38 |
| Molecular Formula: | C25 H25 Br F3 N O3 |
| Smiles: | CC(C)COC(C1C(CC(N(Cc2ccc(cc2)[Br])C=1C)=O)c1ccc(cc1)C(F)(F)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.4057 |
| logD: | 6.4057 |
| logSw: | -5.8228 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 36.978 |
| InChI Key: | GBTQSPMDZAVLGK-OAQYLSRUSA-N |