3-methyl-N-{1-[2-(morpholine-4-carbonyl)phenyl]piperidin-4-yl}butanamide
Chemical Structure Depiction of
3-methyl-N-{1-[2-(morpholine-4-carbonyl)phenyl]piperidin-4-yl}butanamide
3-methyl-N-{1-[2-(morpholine-4-carbonyl)phenyl]piperidin-4-yl}butanamide
Compound characteristics
| Compound ID: | V022-5370 |
| Compound Name: | 3-methyl-N-{1-[2-(morpholine-4-carbonyl)phenyl]piperidin-4-yl}butanamide |
| Molecular Weight: | 373.49 |
| Molecular Formula: | C21 H31 N3 O3 |
| Salt: | not_available |
| Smiles: | CC(C)CC(NC1CCN(CC1)c1ccccc1C(N1CCOCC1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.0569 |
| logD: | 2.0568 |
| logSw: | -2.8574 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.951 |
| InChI Key: | XEALYUBWWQIHFQ-UHFFFAOYSA-N |