4-[(4-bromophenyl)methyl]-2-methyl-N-[(3-methylphenyl)methyl]-4H-thieno[3,2-b]pyrrole-5-carboxamide
Chemical Structure Depiction of
4-[(4-bromophenyl)methyl]-2-methyl-N-[(3-methylphenyl)methyl]-4H-thieno[3,2-b]pyrrole-5-carboxamide
4-[(4-bromophenyl)methyl]-2-methyl-N-[(3-methylphenyl)methyl]-4H-thieno[3,2-b]pyrrole-5-carboxamide
Compound characteristics
| Compound ID: | V022-6156 |
| Compound Name: | 4-[(4-bromophenyl)methyl]-2-methyl-N-[(3-methylphenyl)methyl]-4H-thieno[3,2-b]pyrrole-5-carboxamide |
| Molecular Weight: | 453.4 |
| Molecular Formula: | C23 H21 Br N2 O S |
| Smiles: | Cc1cccc(CNC(c2cc3c(cc(C)s3)n2Cc2ccc(cc2)[Br])=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 6.8086 |
| logD: | 6.8086 |
| logSw: | -5.5985 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 26.1241 |
| InChI Key: | CUMCSGDJQNDCLS-UHFFFAOYSA-N |