N-ethyl-3-[5-(3-fluorophenoxy)-1-(4-fluorophenyl)-3-methyl-1H-pyrazol-4-yl]propanamide
Chemical Structure Depiction of
N-ethyl-3-[5-(3-fluorophenoxy)-1-(4-fluorophenyl)-3-methyl-1H-pyrazol-4-yl]propanamide
N-ethyl-3-[5-(3-fluorophenoxy)-1-(4-fluorophenyl)-3-methyl-1H-pyrazol-4-yl]propanamide
Compound characteristics
| Compound ID: | V022-6196 |
| Compound Name: | N-ethyl-3-[5-(3-fluorophenoxy)-1-(4-fluorophenyl)-3-methyl-1H-pyrazol-4-yl]propanamide |
| Molecular Weight: | 385.41 |
| Molecular Formula: | C21 H21 F2 N3 O2 |
| Smiles: | CCNC(CCc1c(C)nn(c2ccc(cc2)F)c1Oc1cccc(c1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5778 |
| logD: | 3.5778 |
| logSw: | -3.9204 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.017 |
| InChI Key: | PAOCKVDSRYZWQU-UHFFFAOYSA-N |