1-[(cyclopropylmethyl){[5-(3-fluorophenoxy)-1-methyl-3-phenyl-1H-pyrazol-4-yl]methyl}amino]-3-(2-methylphenoxy)propan-2-ol
Chemical Structure Depiction of
1-[(cyclopropylmethyl){[5-(3-fluorophenoxy)-1-methyl-3-phenyl-1H-pyrazol-4-yl]methyl}amino]-3-(2-methylphenoxy)propan-2-ol
1-[(cyclopropylmethyl){[5-(3-fluorophenoxy)-1-methyl-3-phenyl-1H-pyrazol-4-yl]methyl}amino]-3-(2-methylphenoxy)propan-2-ol
Compound characteristics
| Compound ID: | V022-6932 |
| Compound Name: | 1-[(cyclopropylmethyl){[5-(3-fluorophenoxy)-1-methyl-3-phenyl-1H-pyrazol-4-yl]methyl}amino]-3-(2-methylphenoxy)propan-2-ol |
| Molecular Weight: | 515.63 |
| Molecular Formula: | C31 H34 F N3 O3 |
| Salt: | not_available |
| Smiles: | Cc1ccccc1OCC(CN(CC1CC1)Cc1c(c2ccccc2)nn(C)c1Oc1cccc(c1)F)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.2158 |
| logD: | 2.7377 |
| logSw: | -5.8514 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.432 |
| InChI Key: | JESFAUWINSYGDE-SANMLTNESA-N |