1-tert-butoxy-3-(cyclopropyl{[3-ethyl-5-(3-methoxyphenoxy)-1-phenyl-1H-pyrazol-4-yl]methyl}amino)propan-2-ol
Chemical Structure Depiction of
1-tert-butoxy-3-(cyclopropyl{[3-ethyl-5-(3-methoxyphenoxy)-1-phenyl-1H-pyrazol-4-yl]methyl}amino)propan-2-ol
1-tert-butoxy-3-(cyclopropyl{[3-ethyl-5-(3-methoxyphenoxy)-1-phenyl-1H-pyrazol-4-yl]methyl}amino)propan-2-ol
Compound characteristics
| Compound ID: | V022-7920 |
| Compound Name: | 1-tert-butoxy-3-(cyclopropyl{[3-ethyl-5-(3-methoxyphenoxy)-1-phenyl-1H-pyrazol-4-yl]methyl}amino)propan-2-ol |
| Molecular Weight: | 493.65 |
| Molecular Formula: | C29 H39 N3 O4 |
| Salt: | not_available |
| Smiles: | CCc1c(CN(CC(COC(C)(C)C)O)C2CC2)c(n(c2ccccc2)n1)Oc1cccc(c1)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.7613 |
| logD: | 5.2108 |
| logSw: | -5.6385 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.665 |
| InChI Key: | LTZBEXQEDMXUFQ-QHCPKHFHSA-N |