4-(2-chlorophenoxy)-6-methyl-2-{[(3-methylphenyl)methyl]sulfanyl}pyrimidine
Chemical Structure Depiction of
4-(2-chlorophenoxy)-6-methyl-2-{[(3-methylphenyl)methyl]sulfanyl}pyrimidine
4-(2-chlorophenoxy)-6-methyl-2-{[(3-methylphenyl)methyl]sulfanyl}pyrimidine
Compound characteristics
| Compound ID: | V022-7933 |
| Compound Name: | 4-(2-chlorophenoxy)-6-methyl-2-{[(3-methylphenyl)methyl]sulfanyl}pyrimidine |
| Molecular Weight: | 356.87 |
| Molecular Formula: | C19 H17 Cl N2 O S |
| Salt: | not_available |
| Smiles: | Cc1cccc(CSc2nc(C)cc(n2)Oc2ccccc2[Cl])c1 |
| Stereo: | ACHIRAL |
| logP: | 5.9521 |
| logD: | 5.9521 |
| logSw: | -6.1399 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 23.8013 |
| InChI Key: | UKICUYXKWCYDOS-UHFFFAOYSA-N |