N-ethyl-4-{[5-(4-fluorophenoxy)-2-(4-fluorophenyl)-3-oxo-2,3-dihydropyridazin-4-yl]amino}benzamide
Chemical Structure Depiction of
N-ethyl-4-{[5-(4-fluorophenoxy)-2-(4-fluorophenyl)-3-oxo-2,3-dihydropyridazin-4-yl]amino}benzamide
N-ethyl-4-{[5-(4-fluorophenoxy)-2-(4-fluorophenyl)-3-oxo-2,3-dihydropyridazin-4-yl]amino}benzamide
Compound characteristics
| Compound ID: | V022-9047 |
| Compound Name: | N-ethyl-4-{[5-(4-fluorophenoxy)-2-(4-fluorophenyl)-3-oxo-2,3-dihydropyridazin-4-yl]amino}benzamide |
| Molecular Weight: | 462.45 |
| Molecular Formula: | C25 H20 F2 N4 O3 |
| Smiles: | CCNC(c1ccc(cc1)NC1=C(C=NN(C1=O)c1ccc(cc1)F)Oc1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6342 |
| logD: | 3.5287 |
| logSw: | -3.9169 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 67.627 |
| InChI Key: | STAIJUIJXNIWAD-UHFFFAOYSA-N |