1-({[5-(3-fluorophenoxy)-3-methyl-1-phenyl-1H-pyrazol-4-yl]methyl}[(furan-2-yl)methyl]amino)-3-[(propan-2-yl)oxy]propan-2-ol
Chemical Structure Depiction of
1-({[5-(3-fluorophenoxy)-3-methyl-1-phenyl-1H-pyrazol-4-yl]methyl}[(furan-2-yl)methyl]amino)-3-[(propan-2-yl)oxy]propan-2-ol
1-({[5-(3-fluorophenoxy)-3-methyl-1-phenyl-1H-pyrazol-4-yl]methyl}[(furan-2-yl)methyl]amino)-3-[(propan-2-yl)oxy]propan-2-ol
Compound characteristics
| Compound ID: | V022-9235 |
| Compound Name: | 1-({[5-(3-fluorophenoxy)-3-methyl-1-phenyl-1H-pyrazol-4-yl]methyl}[(furan-2-yl)methyl]amino)-3-[(propan-2-yl)oxy]propan-2-ol |
| Molecular Weight: | 493.58 |
| Molecular Formula: | C28 H32 F N3 O4 |
| Salt: | not_available |
| Smiles: | CC(C)OCC(CN(Cc1c(C)nn(c2ccccc2)c1Oc1cccc(c1)F)Cc1ccco1)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.9146 |
| logD: | 4.5223 |
| logSw: | -4.7371 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.283 |
| InChI Key: | RVOQDOIRXXNXMG-DEOSSOPVSA-N |