N-ethyl-N-methyl-2-(3-methylphenyl)-4-[(3-methylphenyl)methyl]-3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazine-6-carboxamide
Chemical Structure Depiction of
N-ethyl-N-methyl-2-(3-methylphenyl)-4-[(3-methylphenyl)methyl]-3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazine-6-carboxamide
N-ethyl-N-methyl-2-(3-methylphenyl)-4-[(3-methylphenyl)methyl]-3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazine-6-carboxamide
Compound characteristics
| Compound ID: | V023-0089 |
| Compound Name: | N-ethyl-N-methyl-2-(3-methylphenyl)-4-[(3-methylphenyl)methyl]-3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazine-6-carboxamide |
| Molecular Weight: | 392.46 |
| Molecular Formula: | C22 H24 N4 O3 |
| Smiles: | CCN(C)C(C1C(N(Cc2cccc(C)c2)C(N(c2cccc(C)c2)N=1)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7578 |
| logD: | 3.7578 |
| logSw: | -3.8217 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 58.392 |
| InChI Key: | AWXSKPONARBZMO-UHFFFAOYSA-N |