N-cyclopropyl-N-({5-[(2-fluorophenyl)methyl]-1-(2-methoxyphenyl)-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridin-3-yl}methyl)cyclopentanecarboxamide
Chemical Structure Depiction of
N-cyclopropyl-N-({5-[(2-fluorophenyl)methyl]-1-(2-methoxyphenyl)-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridin-3-yl}methyl)cyclopentanecarboxamide
N-cyclopropyl-N-({5-[(2-fluorophenyl)methyl]-1-(2-methoxyphenyl)-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridin-3-yl}methyl)cyclopentanecarboxamide
Compound characteristics
| Compound ID: | V023-1447 |
| Compound Name: | N-cyclopropyl-N-({5-[(2-fluorophenyl)methyl]-1-(2-methoxyphenyl)-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridin-3-yl}methyl)cyclopentanecarboxamide |
| Molecular Weight: | 502.63 |
| Molecular Formula: | C30 H35 F N4 O2 |
| Salt: | not_available |
| Smiles: | COc1ccccc1n1c2CCN(Cc3ccccc3F)Cc2c(CN(C2CC2)C(C2CCCC2)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 5.2115 |
| logD: | 1.9621 |
| logSw: | -5.0352 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 42.127 |
| InChI Key: | WWBUICFSGUPACD-UHFFFAOYSA-N |