N-butyl-5-({6-[(3-methoxyphenoxy)acetyl]-3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl}methyl)furan-2-carboxamide
Chemical Structure Depiction of
N-butyl-5-({6-[(3-methoxyphenoxy)acetyl]-3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl}methyl)furan-2-carboxamide
N-butyl-5-({6-[(3-methoxyphenoxy)acetyl]-3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl}methyl)furan-2-carboxamide
Compound characteristics
| Compound ID: | V023-2326 |
| Compound Name: | N-butyl-5-({6-[(3-methoxyphenoxy)acetyl]-3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl}methyl)furan-2-carboxamide |
| Molecular Weight: | 492.53 |
| Molecular Formula: | C27 H28 N2 O7 |
| Smiles: | CCCCNC(c1ccc(CN2C(COc3ccc(cc23)C(COc2cccc(c2)OC)=O)=O)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7741 |
| logD: | 3.7741 |
| logSw: | -4.0803 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 84.454 |
| InChI Key: | QOLMOCXXTODBIC-UHFFFAOYSA-N |