4-(4-methylphenoxy)-2-{[(4-methylphenyl)methyl]sulfanyl}-6-(trifluoromethyl)pyrimidine
Chemical Structure Depiction of
4-(4-methylphenoxy)-2-{[(4-methylphenyl)methyl]sulfanyl}-6-(trifluoromethyl)pyrimidine
4-(4-methylphenoxy)-2-{[(4-methylphenyl)methyl]sulfanyl}-6-(trifluoromethyl)pyrimidine
Compound characteristics
| Compound ID: | V023-2523 |
| Compound Name: | 4-(4-methylphenoxy)-2-{[(4-methylphenyl)methyl]sulfanyl}-6-(trifluoromethyl)pyrimidine |
| Molecular Weight: | 390.43 |
| Molecular Formula: | C20 H17 F3 N2 O S |
| Salt: | not_available |
| Smiles: | Cc1ccc(CSc2nc(cc(n2)Oc2ccc(C)cc2)C(F)(F)F)cc1 |
| Stereo: | ACHIRAL |
| logP: | 6.1158 |
| logD: | 6.1158 |
| logSw: | -5.5545 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 23.9083 |
| InChI Key: | AHRCIKISQYQQJK-UHFFFAOYSA-N |