N-(cyclopropylmethyl)-3-[(4-fluorophenyl)methyl]-5-[4-(4-methoxybenzamido)phenyl]-2-oxo-1,3-oxazolidine-4-carboxamide
Chemical Structure Depiction of
N-(cyclopropylmethyl)-3-[(4-fluorophenyl)methyl]-5-[4-(4-methoxybenzamido)phenyl]-2-oxo-1,3-oxazolidine-4-carboxamide
N-(cyclopropylmethyl)-3-[(4-fluorophenyl)methyl]-5-[4-(4-methoxybenzamido)phenyl]-2-oxo-1,3-oxazolidine-4-carboxamide
Compound characteristics
| Compound ID: | V023-3213 |
| Compound Name: | N-(cyclopropylmethyl)-3-[(4-fluorophenyl)methyl]-5-[4-(4-methoxybenzamido)phenyl]-2-oxo-1,3-oxazolidine-4-carboxamide |
| Molecular Weight: | 517.56 |
| Molecular Formula: | C29 H28 F N3 O5 |
| Smiles: | COc1ccc(cc1)C(Nc1ccc(cc1)C1C(C(NCC2CC2)=O)N(Cc2ccc(cc2)F)C(=O)O1)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.0731 |
| logD: | 4.0731 |
| logSw: | -4.2298 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 79.738 |
| InChI Key: | QWNQNWQFRICFQS-UHFFFAOYSA-N |