N,N-diethyl-2-(4-{[(4-fluorophenyl)carbamothioyl]amino}piperidin-1-yl)benzamide
Chemical Structure Depiction of
N,N-diethyl-2-(4-{[(4-fluorophenyl)carbamothioyl]amino}piperidin-1-yl)benzamide
N,N-diethyl-2-(4-{[(4-fluorophenyl)carbamothioyl]amino}piperidin-1-yl)benzamide
Compound characteristics
| Compound ID: | V023-3248 |
| Compound Name: | N,N-diethyl-2-(4-{[(4-fluorophenyl)carbamothioyl]amino}piperidin-1-yl)benzamide |
| Molecular Weight: | 428.57 |
| Molecular Formula: | C23 H29 F N4 O S |
| Salt: | not_available |
| Smiles: | CCN(CC)C(c1ccccc1N1CCC(CC1)NC(Nc1ccc(cc1)F)=S)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7402 |
| logD: | 3.7402 |
| logSw: | -4.0511 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 39 |
| InChI Key: | SRDZJSGODOVSEE-UHFFFAOYSA-N |