4-fluoro-N-propyl-N-({2-[(2,3,5-trimethylphenoxy)methyl]-1,3-thiazol-4-yl}methyl)benzamide
Chemical Structure Depiction of
4-fluoro-N-propyl-N-({2-[(2,3,5-trimethylphenoxy)methyl]-1,3-thiazol-4-yl}methyl)benzamide
4-fluoro-N-propyl-N-({2-[(2,3,5-trimethylphenoxy)methyl]-1,3-thiazol-4-yl}methyl)benzamide
Compound characteristics
| Compound ID: | V023-4868 |
| Compound Name: | 4-fluoro-N-propyl-N-({2-[(2,3,5-trimethylphenoxy)methyl]-1,3-thiazol-4-yl}methyl)benzamide |
| Molecular Weight: | 426.55 |
| Molecular Formula: | C24 H27 F N2 O2 S |
| Smiles: | CCCN(Cc1csc(COc2cc(C)cc(C)c2C)n1)C(c1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.9751 |
| logD: | 5.9751 |
| logSw: | -5.5096 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 34.738 |
| InChI Key: | BQWXRSCALKBTIU-UHFFFAOYSA-N |