N-[(4-fluorophenyl)methyl]-N-(2-{4-[6-(3-methoxyphenyl)pyridazin-3-yl]piperazin-1-yl}-2-oxoethyl)benzamide
Chemical Structure Depiction of
N-[(4-fluorophenyl)methyl]-N-(2-{4-[6-(3-methoxyphenyl)pyridazin-3-yl]piperazin-1-yl}-2-oxoethyl)benzamide
N-[(4-fluorophenyl)methyl]-N-(2-{4-[6-(3-methoxyphenyl)pyridazin-3-yl]piperazin-1-yl}-2-oxoethyl)benzamide
Compound characteristics
| Compound ID: | V023-4878 |
| Compound Name: | N-[(4-fluorophenyl)methyl]-N-(2-{4-[6-(3-methoxyphenyl)pyridazin-3-yl]piperazin-1-yl}-2-oxoethyl)benzamide |
| Molecular Weight: | 539.61 |
| Molecular Formula: | C31 H30 F N5 O3 |
| Salt: | not_available |
| Smiles: | COc1cccc(c1)c1ccc(nn1)N1CCN(CC1)C(CN(Cc1ccc(cc1)F)C(c1ccccc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.919 |
| logD: | 3.8071 |
| logSw: | -4.0614 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 64.309 |
| InChI Key: | UPVJFBHKLFRAQI-UHFFFAOYSA-N |