methyl [1-(2-{[(furan-2-yl)methyl](methyl)carbamoyl}phenyl)piperidin-4-yl]carbamate
Chemical Structure Depiction of
methyl [1-(2-{[(furan-2-yl)methyl](methyl)carbamoyl}phenyl)piperidin-4-yl]carbamate
methyl [1-(2-{[(furan-2-yl)methyl](methyl)carbamoyl}phenyl)piperidin-4-yl]carbamate
Compound characteristics
| Compound ID: | V023-4979 |
| Compound Name: | methyl [1-(2-{[(furan-2-yl)methyl](methyl)carbamoyl}phenyl)piperidin-4-yl]carbamate |
| Molecular Weight: | 371.43 |
| Molecular Formula: | C20 H25 N3 O4 |
| Salt: | not_available |
| Smiles: | CN(Cc1ccco1)C(c1ccccc1N1CCC(CC1)NC(=O)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1882 |
| logD: | 2.1881 |
| logSw: | -2.8818 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.008 |
| InChI Key: | PHVJQLUESQJEKZ-UHFFFAOYSA-N |