1-(3-methylbutyl)-3-(4-methylphenyl)-7-[(3-methylphenyl)methyl]-3,7-dihydro-1H-purine-2,6-dione
Chemical Structure Depiction of
1-(3-methylbutyl)-3-(4-methylphenyl)-7-[(3-methylphenyl)methyl]-3,7-dihydro-1H-purine-2,6-dione
1-(3-methylbutyl)-3-(4-methylphenyl)-7-[(3-methylphenyl)methyl]-3,7-dihydro-1H-purine-2,6-dione
Compound characteristics
| Compound ID: | V023-6868 |
| Compound Name: | 1-(3-methylbutyl)-3-(4-methylphenyl)-7-[(3-methylphenyl)methyl]-3,7-dihydro-1H-purine-2,6-dione |
| Molecular Weight: | 416.52 |
| Molecular Formula: | C25 H28 N4 O2 |
| Salt: | not_available |
| Smiles: | CC(C)CCN1C(c2c(ncn2Cc2cccc(C)c2)N(C1=O)c1ccc(C)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0544 |
| logD: | 5.0544 |
| logSw: | -4.6023 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 42.524 |
| InChI Key: | QJOFGTYGSGZXOV-UHFFFAOYSA-N |