ethyl 1-{2-bromo-4-[(2-methoxyphenyl)methyl]-4H-thieno[3,2-b]pyrrole-5-carbonyl}piperidine-4-carboxylate
Chemical Structure Depiction of
ethyl 1-{2-bromo-4-[(2-methoxyphenyl)methyl]-4H-thieno[3,2-b]pyrrole-5-carbonyl}piperidine-4-carboxylate
ethyl 1-{2-bromo-4-[(2-methoxyphenyl)methyl]-4H-thieno[3,2-b]pyrrole-5-carbonyl}piperidine-4-carboxylate
Compound characteristics
| Compound ID: | V023-7028 |
| Compound Name: | ethyl 1-{2-bromo-4-[(2-methoxyphenyl)methyl]-4H-thieno[3,2-b]pyrrole-5-carbonyl}piperidine-4-carboxylate |
| Molecular Weight: | 505.43 |
| Molecular Formula: | C23 H25 Br N2 O4 S |
| Smiles: | CCOC(C1CCN(CC1)C(c1cc2c(cc(s2)[Br])n1Cc1ccccc1OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.995 |
| logD: | 4.995 |
| logSw: | -4.6178 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 46.743 |
| InChI Key: | OXMKDZFMHDYWKR-UHFFFAOYSA-N |