N-({4-[(2,3-difluorophenyl)methyl]morpholin-2-yl}methyl)-N-(2-methylpropyl)-4-(trifluoromethyl)benzamide
Chemical Structure Depiction of
N-({4-[(2,3-difluorophenyl)methyl]morpholin-2-yl}methyl)-N-(2-methylpropyl)-4-(trifluoromethyl)benzamide
N-({4-[(2,3-difluorophenyl)methyl]morpholin-2-yl}methyl)-N-(2-methylpropyl)-4-(trifluoromethyl)benzamide
Compound characteristics
| Compound ID: | V023-8734 |
| Compound Name: | N-({4-[(2,3-difluorophenyl)methyl]morpholin-2-yl}methyl)-N-(2-methylpropyl)-4-(trifluoromethyl)benzamide |
| Molecular Weight: | 470.48 |
| Molecular Formula: | C24 H27 F5 N2 O2 |
| Salt: | not_available |
| Smiles: | CC(C)CN(CC1CN(CCO1)Cc1cccc(c1F)F)C(c1ccc(cc1)C(F)(F)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.9868 |
| logD: | 4.9838 |
| logSw: | -4.5655 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 28.2117 |
| InChI Key: | JMPRSZAHAJABRG-HXUWFJFHSA-N |