N-(2-{4-[(4-chloro-3-methylphenoxy)methyl]-6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl}-2-oxoethyl)-N-(cyclopropylmethyl)-2-methoxyacetamide
Chemical Structure Depiction of
N-(2-{4-[(4-chloro-3-methylphenoxy)methyl]-6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl}-2-oxoethyl)-N-(cyclopropylmethyl)-2-methoxyacetamide
N-(2-{4-[(4-chloro-3-methylphenoxy)methyl]-6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl}-2-oxoethyl)-N-(cyclopropylmethyl)-2-methoxyacetamide
Compound characteristics
| Compound ID: | V023-8742 |
| Compound Name: | N-(2-{4-[(4-chloro-3-methylphenoxy)methyl]-6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl}-2-oxoethyl)-N-(cyclopropylmethyl)-2-methoxyacetamide |
| Molecular Weight: | 477.02 |
| Molecular Formula: | C24 H29 Cl N2 O4 S |
| Smiles: | Cc1cc(ccc1[Cl])OCC1c2ccsc2CCN1C(CN(CC1CC1)C(COC)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3568 |
| logD: | 4.3568 |
| logSw: | -4.4893 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 48.706 |
| InChI Key: | ICBHBDNQRLZCTP-NRFANRHFSA-N |