3-({[4-(diethylamino)-6-(propan-2-yl)pyrimidin-2-yl]sulfanyl}methyl)-N-(2-methoxyethyl)benzamide
Chemical Structure Depiction of
3-({[4-(diethylamino)-6-(propan-2-yl)pyrimidin-2-yl]sulfanyl}methyl)-N-(2-methoxyethyl)benzamide
3-({[4-(diethylamino)-6-(propan-2-yl)pyrimidin-2-yl]sulfanyl}methyl)-N-(2-methoxyethyl)benzamide
Compound characteristics
| Compound ID: | V023-9194 |
| Compound Name: | 3-({[4-(diethylamino)-6-(propan-2-yl)pyrimidin-2-yl]sulfanyl}methyl)-N-(2-methoxyethyl)benzamide |
| Molecular Weight: | 416.58 |
| Molecular Formula: | C22 H32 N4 O2 S |
| Salt: | not_available |
| Smiles: | CCN(CC)c1cc(C(C)C)nc(n1)SCc1cccc(c1)C(NCCOC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6083 |
| logD: | 4.6078 |
| logSw: | -4.3536 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.329 |
| InChI Key: | LBJDOWPTUZVWST-UHFFFAOYSA-N |