3-chloro-N-[6-(4-{[4-(dimethylamino)phenyl]methyl}piperazin-1-yl)pyridin-3-yl]-4-methylbenzene-1-sulfonamide
Chemical Structure Depiction of
3-chloro-N-[6-(4-{[4-(dimethylamino)phenyl]methyl}piperazin-1-yl)pyridin-3-yl]-4-methylbenzene-1-sulfonamide
3-chloro-N-[6-(4-{[4-(dimethylamino)phenyl]methyl}piperazin-1-yl)pyridin-3-yl]-4-methylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | V023-9624 |
| Compound Name: | 3-chloro-N-[6-(4-{[4-(dimethylamino)phenyl]methyl}piperazin-1-yl)pyridin-3-yl]-4-methylbenzene-1-sulfonamide |
| Molecular Weight: | 500.06 |
| Molecular Formula: | C25 H30 Cl N5 O2 S |
| Salt: | not_available |
| Smiles: | Cc1ccc(cc1[Cl])S(Nc1ccc(nc1)N1CCN(CC1)Cc1ccc(cc1)N(C)C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2424 |
| logD: | 4.9982 |
| logSw: | -5.7565 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.287 |
| InChI Key: | YKZSTNHJILXCNF-UHFFFAOYSA-N |