4-[4-(2-chlorophenyl)piperazin-1-yl]-N-[(3-methylphenyl)methyl]phthalazine-1-carboxamide
Chemical Structure Depiction of
4-[4-(2-chlorophenyl)piperazin-1-yl]-N-[(3-methylphenyl)methyl]phthalazine-1-carboxamide
4-[4-(2-chlorophenyl)piperazin-1-yl]-N-[(3-methylphenyl)methyl]phthalazine-1-carboxamide
Compound characteristics
| Compound ID: | V023-9817 |
| Compound Name: | 4-[4-(2-chlorophenyl)piperazin-1-yl]-N-[(3-methylphenyl)methyl]phthalazine-1-carboxamide |
| Molecular Weight: | 471.99 |
| Molecular Formula: | C27 H26 Cl N5 O |
| Salt: | not_available |
| Smiles: | Cc1cccc(CNC(c2c3ccccc3c(nn2)N2CCN(CC2)c2ccccc2[Cl])=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 5.7315 |
| logD: | 5.7315 |
| logSw: | -5.9481 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.238 |
| InChI Key: | LVHUHDFJAVDSES-UHFFFAOYSA-N |