1-cyclopropyl-7-ethyl-3-(3-methylphenyl)-3,7-dihydro-1H-purine-2,6-dione
Chemical Structure Depiction of
1-cyclopropyl-7-ethyl-3-(3-methylphenyl)-3,7-dihydro-1H-purine-2,6-dione
1-cyclopropyl-7-ethyl-3-(3-methylphenyl)-3,7-dihydro-1H-purine-2,6-dione
Compound characteristics
| Compound ID: | V024-1067 |
| Compound Name: | 1-cyclopropyl-7-ethyl-3-(3-methylphenyl)-3,7-dihydro-1H-purine-2,6-dione |
| Molecular Weight: | 310.35 |
| Molecular Formula: | C17 H18 N4 O2 |
| Smiles: | CCn1cnc2c1C(N(C1CC1)C(N2c1cccc(C)c1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1339 |
| logD: | 2.1339 |
| logSw: | -2.4095 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 41.823 |
| InChI Key: | IOQKDMNULPQFTL-UHFFFAOYSA-N |