N-(2-methoxyethyl)-N-({2-[(2-methylphenyl)methanesulfonyl]-1-(2-methylpropyl)-1H-imidazol-5-yl}methyl)-2-phenylacetamide
Chemical Structure Depiction of
N-(2-methoxyethyl)-N-({2-[(2-methylphenyl)methanesulfonyl]-1-(2-methylpropyl)-1H-imidazol-5-yl}methyl)-2-phenylacetamide
N-(2-methoxyethyl)-N-({2-[(2-methylphenyl)methanesulfonyl]-1-(2-methylpropyl)-1H-imidazol-5-yl}methyl)-2-phenylacetamide
Compound characteristics
| Compound ID: | V024-2657 |
| Compound Name: | N-(2-methoxyethyl)-N-({2-[(2-methylphenyl)methanesulfonyl]-1-(2-methylpropyl)-1H-imidazol-5-yl}methyl)-2-phenylacetamide |
| Molecular Weight: | 497.66 |
| Molecular Formula: | C27 H35 N3 O4 S |
| Salt: | not_available |
| Smiles: | CC(C)Cn1c(CN(CCOC)C(Cc2ccccc2)=O)cnc1S(Cc1ccccc1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7832 |
| logD: | 4.7832 |
| logSw: | -4.3895 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 64.928 |
| InChI Key: | NHCBVFSOOROIMY-UHFFFAOYSA-N |