N-[2-(dimethylamino)ethyl]-2-({[(2,4-dimethylphenyl)methyl](1-phenylethyl)amino}methyl)-1,3-oxazole-4-carboxamide
Chemical Structure Depiction of
N-[2-(dimethylamino)ethyl]-2-({[(2,4-dimethylphenyl)methyl](1-phenylethyl)amino}methyl)-1,3-oxazole-4-carboxamide
N-[2-(dimethylamino)ethyl]-2-({[(2,4-dimethylphenyl)methyl](1-phenylethyl)amino}methyl)-1,3-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | V024-2905 |
| Compound Name: | N-[2-(dimethylamino)ethyl]-2-({[(2,4-dimethylphenyl)methyl](1-phenylethyl)amino}methyl)-1,3-oxazole-4-carboxamide |
| Molecular Weight: | 434.58 |
| Molecular Formula: | C26 H34 N4 O2 |
| Salt: | not_available |
| Smiles: | CC(c1ccccc1)N(Cc1ccc(C)cc1C)Cc1nc(co1)C(NCCN(C)C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.2095 |
| logD: | 3.0682 |
| logSw: | -4.0602 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.732 |
| InChI Key: | FNTSLLJGFZYNRN-NRFANRHFSA-N |