N-cyclohexyl-N-(2-{[2-(3,4-dimethoxyphenyl)ethyl][(5-methylfuran-2-yl)methyl]amino}-2-oxoethyl)-2-fluorobenzamide
Chemical Structure Depiction of
N-cyclohexyl-N-(2-{[2-(3,4-dimethoxyphenyl)ethyl][(5-methylfuran-2-yl)methyl]amino}-2-oxoethyl)-2-fluorobenzamide
N-cyclohexyl-N-(2-{[2-(3,4-dimethoxyphenyl)ethyl][(5-methylfuran-2-yl)methyl]amino}-2-oxoethyl)-2-fluorobenzamide
Compound characteristics
| Compound ID: | V024-3537 |
| Compound Name: | N-cyclohexyl-N-(2-{[2-(3,4-dimethoxyphenyl)ethyl][(5-methylfuran-2-yl)methyl]amino}-2-oxoethyl)-2-fluorobenzamide |
| Molecular Weight: | 536.64 |
| Molecular Formula: | C31 H37 F N2 O5 |
| Smiles: | Cc1ccc(CN(CCc2ccc(c(c2)OC)OC)C(CN(C2CCCCC2)C(c2ccccc2F)=O)=O)o1 |
| Stereo: | ACHIRAL |
| logP: | 5.1781 |
| logD: | 5.1781 |
| logSw: | -4.9442 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 53.608 |
| InChI Key: | HNWQZPCDXPVZFP-UHFFFAOYSA-N |