N-(2-{4-[4-(2-fluorobenzoyl)piperazin-1-yl]anilino}-2-oxoethyl)-N-[(4-fluorophenyl)methyl]cyclopentanecarboxamide
Chemical Structure Depiction of
N-(2-{4-[4-(2-fluorobenzoyl)piperazin-1-yl]anilino}-2-oxoethyl)-N-[(4-fluorophenyl)methyl]cyclopentanecarboxamide
N-(2-{4-[4-(2-fluorobenzoyl)piperazin-1-yl]anilino}-2-oxoethyl)-N-[(4-fluorophenyl)methyl]cyclopentanecarboxamide
Compound characteristics
| Compound ID: | V024-5000 |
| Compound Name: | N-(2-{4-[4-(2-fluorobenzoyl)piperazin-1-yl]anilino}-2-oxoethyl)-N-[(4-fluorophenyl)methyl]cyclopentanecarboxamide |
| Molecular Weight: | 560.64 |
| Molecular Formula: | C32 H34 F2 N4 O3 |
| Salt: | not_available |
| Smiles: | C1CCC(C1)C(N(CC(Nc1ccc(cc1)N1CCN(CC1)C(c1ccccc1F)=O)=O)Cc1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8398 |
| logD: | 4.8397 |
| logSw: | -4.6813 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.794 |
| InChI Key: | RLEQHAYYKALRDT-UHFFFAOYSA-N |