1-(1-benzylpiperidin-4-yl)-3-(butan-2-yl)-2-oxo-N-propyl-1,4,8-triazaspiro[4.5]decane-8-carbothioamide
Chemical Structure Depiction of
1-(1-benzylpiperidin-4-yl)-3-(butan-2-yl)-2-oxo-N-propyl-1,4,8-triazaspiro[4.5]decane-8-carbothioamide
1-(1-benzylpiperidin-4-yl)-3-(butan-2-yl)-2-oxo-N-propyl-1,4,8-triazaspiro[4.5]decane-8-carbothioamide
Compound characteristics
| Compound ID: | V024-6663 |
| Compound Name: | 1-(1-benzylpiperidin-4-yl)-3-(butan-2-yl)-2-oxo-N-propyl-1,4,8-triazaspiro[4.5]decane-8-carbothioamide |
| Molecular Weight: | 485.74 |
| Molecular Formula: | C27 H43 N5 O S |
| Salt: | not_available |
| Smiles: | CCCNC(N1CCC2(CC1)NC(C(C)CC)C(N2C1CCN(CC1)Cc1ccccc1)=O)=S |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.0358 |
| logD: | 1.8221 |
| logSw: | -3.9186 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 43.661 |
| InChI Key: | LKILRSJWGMPWAS-UHFFFAOYSA-N |