N-[(3,4-dichlorophenyl)methyl]-N~2~-[(2,6-difluorophenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]-N~2~-(propan-2-yl)glycinamide
Chemical Structure Depiction of
N-[(3,4-dichlorophenyl)methyl]-N~2~-[(2,6-difluorophenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]-N~2~-(propan-2-yl)glycinamide
N-[(3,4-dichlorophenyl)methyl]-N~2~-[(2,6-difluorophenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]-N~2~-(propan-2-yl)glycinamide
Compound characteristics
| Compound ID: | V024-7074 |
| Compound Name: | N-[(3,4-dichlorophenyl)methyl]-N~2~-[(2,6-difluorophenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]-N~2~-(propan-2-yl)glycinamide |
| Molecular Weight: | 544.47 |
| Molecular Formula: | C29 H29 Cl2 F2 N3 O |
| Salt: | not_available |
| Smiles: | CC(C)N(CC(N(CCc1c[nH]c2ccccc12)Cc1ccc(c(c1)[Cl])[Cl])=O)Cc1c(cccc1F)F |
| Stereo: | ACHIRAL |
| logP: | 6.5527 |
| logD: | 6.5494 |
| logSw: | -6.3644 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 29.1186 |
| InChI Key: | NXZBQAMVSYRVGU-UHFFFAOYSA-N |