N~2~-benzyl-N-[1-(3,4-dimethoxyphenyl)-4-phenyl-1H-imidazol-2-yl]-N~2~-(4-methylbenzene-1-sulfonyl)glycinamide
Chemical Structure Depiction of
N~2~-benzyl-N-[1-(3,4-dimethoxyphenyl)-4-phenyl-1H-imidazol-2-yl]-N~2~-(4-methylbenzene-1-sulfonyl)glycinamide
N~2~-benzyl-N-[1-(3,4-dimethoxyphenyl)-4-phenyl-1H-imidazol-2-yl]-N~2~-(4-methylbenzene-1-sulfonyl)glycinamide
Compound characteristics
| Compound ID: | V024-7089 |
| Compound Name: | N~2~-benzyl-N-[1-(3,4-dimethoxyphenyl)-4-phenyl-1H-imidazol-2-yl]-N~2~-(4-methylbenzene-1-sulfonyl)glycinamide |
| Molecular Weight: | 596.71 |
| Molecular Formula: | C33 H32 N4 O5 S |
| Salt: | not_available |
| Smiles: | Cc1ccc(cc1)S(N(CC(Nc1nc(cn1c1ccc(c(c1)OC)OC)c1ccccc1)=O)Cc1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 6.2611 |
| logD: | 6.2611 |
| logSw: | -5.3218 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 82.818 |
| InChI Key: | JCSXFRFBUCPQPO-UHFFFAOYSA-N |