N-{4-[5-(2H-1,3-benzodioxol-5-yl)-3-(2-methoxyethoxy)-1H-1,2,4-triazol-1-yl]phenyl}-4-methoxybenzamide
Chemical Structure Depiction of
N-{4-[5-(2H-1,3-benzodioxol-5-yl)-3-(2-methoxyethoxy)-1H-1,2,4-triazol-1-yl]phenyl}-4-methoxybenzamide
N-{4-[5-(2H-1,3-benzodioxol-5-yl)-3-(2-methoxyethoxy)-1H-1,2,4-triazol-1-yl]phenyl}-4-methoxybenzamide
Compound characteristics
| Compound ID: | V024-7216 |
| Compound Name: | N-{4-[5-(2H-1,3-benzodioxol-5-yl)-3-(2-methoxyethoxy)-1H-1,2,4-triazol-1-yl]phenyl}-4-methoxybenzamide |
| Molecular Weight: | 488.5 |
| Molecular Formula: | C26 H24 N4 O6 |
| Salt: | not_available |
| Smiles: | COCCOc1nc(c2ccc3c(c2)OCO3)n(c2ccc(cc2)NC(c2ccc(cc2)OC)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 4.0996 |
| logD: | 4.0996 |
| logSw: | -4.3514 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 87.201 |
| InChI Key: | DOAQTZYPARVGIG-UHFFFAOYSA-N |