{4-[(2-fluorophenyl)methyl]-2-methyl-4H-thieno[3,2-b]pyrrol-5-yl}(morpholin-4-yl)methanone
Chemical Structure Depiction of
{4-[(2-fluorophenyl)methyl]-2-methyl-4H-thieno[3,2-b]pyrrol-5-yl}(morpholin-4-yl)methanone
{4-[(2-fluorophenyl)methyl]-2-methyl-4H-thieno[3,2-b]pyrrol-5-yl}(morpholin-4-yl)methanone
Compound characteristics
| Compound ID: | V024-7401 |
| Compound Name: | {4-[(2-fluorophenyl)methyl]-2-methyl-4H-thieno[3,2-b]pyrrol-5-yl}(morpholin-4-yl)methanone |
| Molecular Weight: | 358.43 |
| Molecular Formula: | C19 H19 F N2 O2 S |
| Smiles: | Cc1cc2c(cc(C(N3CCOCC3)=O)n2Cc2ccccc2F)s1 |
| Stereo: | ACHIRAL |
| logP: | 3.9218 |
| logD: | 3.9218 |
| logSw: | -3.8992 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 26.2676 |
| InChI Key: | SIEHXWKJMQSQAZ-UHFFFAOYSA-N |