{4-[1-(3-chlorophenyl)-6-cyclopropyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl]piperazin-1-yl}(2-fluorophenyl)methanone
Chemical Structure Depiction of
{4-[1-(3-chlorophenyl)-6-cyclopropyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl]piperazin-1-yl}(2-fluorophenyl)methanone
{4-[1-(3-chlorophenyl)-6-cyclopropyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl]piperazin-1-yl}(2-fluorophenyl)methanone
Compound characteristics
| Compound ID: | V024-7571 |
| Compound Name: | {4-[1-(3-chlorophenyl)-6-cyclopropyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl]piperazin-1-yl}(2-fluorophenyl)methanone |
| Molecular Weight: | 476.94 |
| Molecular Formula: | C25 H22 Cl F N6 O |
| Salt: | not_available |
| Smiles: | C1CC1c1nc(c2cnn(c3cccc(c3)[Cl])c2n1)N1CCN(CC1)C(c1ccccc1F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.397 |
| logD: | 4.7063 |
| logSw: | -6.008 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 53.33 |
| InChI Key: | SXMQXWDPRBIBRW-UHFFFAOYSA-N |