{4-[3,6-dimethyl-1-(3-methylphenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-yl]piperazin-1-yl}(4-fluorophenyl)methanone
Chemical Structure Depiction of
{4-[3,6-dimethyl-1-(3-methylphenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-yl]piperazin-1-yl}(4-fluorophenyl)methanone
{4-[3,6-dimethyl-1-(3-methylphenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-yl]piperazin-1-yl}(4-fluorophenyl)methanone
Compound characteristics
| Compound ID: | V024-7707 |
| Compound Name: | {4-[3,6-dimethyl-1-(3-methylphenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-yl]piperazin-1-yl}(4-fluorophenyl)methanone |
| Molecular Weight: | 444.51 |
| Molecular Formula: | C25 H25 F N6 O |
| Salt: | not_available |
| Smiles: | Cc1cccc(c1)n1c2c(c(C)n1)c(nc(C)n2)N1CCN(CC1)C(c1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.075 |
| logD: | 3.2237 |
| logSw: | -4.3939 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 53.044 |
| InChI Key: | HHBJSXOHBOWHHO-UHFFFAOYSA-N |