N-[4-(dimethylamino)-3-({2-ethyl-N-[(4-fluorophenyl)methyl]butanamido}methyl)phenyl]cyclopropanecarboxamide
Chemical Structure Depiction of
N-[4-(dimethylamino)-3-({2-ethyl-N-[(4-fluorophenyl)methyl]butanamido}methyl)phenyl]cyclopropanecarboxamide
N-[4-(dimethylamino)-3-({2-ethyl-N-[(4-fluorophenyl)methyl]butanamido}methyl)phenyl]cyclopropanecarboxamide
Compound characteristics
| Compound ID: | V024-8796 |
| Compound Name: | N-[4-(dimethylamino)-3-({2-ethyl-N-[(4-fluorophenyl)methyl]butanamido}methyl)phenyl]cyclopropanecarboxamide |
| Molecular Weight: | 439.57 |
| Molecular Formula: | C26 H34 F N3 O2 |
| Salt: | not_available |
| Smiles: | CCC(CC)C(N(Cc1ccc(cc1)F)Cc1cc(ccc1N(C)C)NC(C1CC1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1789 |
| logD: | 5.1766 |
| logSw: | -5.0742 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.568 |
| InChI Key: | AMGZNEQVGNOEFO-UHFFFAOYSA-N |