N-[3-{[tert-butyl-N-(1-phenylethyl)carbamamido]methyl}-4-(dimethylamino)phenyl]-3,3-dimethylbutanamide
Chemical Structure Depiction of
N-[3-{[tert-butyl-N-(1-phenylethyl)carbamamido]methyl}-4-(dimethylamino)phenyl]-3,3-dimethylbutanamide
N-[3-{[tert-butyl-N-(1-phenylethyl)carbamamido]methyl}-4-(dimethylamino)phenyl]-3,3-dimethylbutanamide
Compound characteristics
| Compound ID: | V024-8798 |
| Compound Name: | N-[3-{[tert-butyl-N-(1-phenylethyl)carbamamido]methyl}-4-(dimethylamino)phenyl]-3,3-dimethylbutanamide |
| Molecular Weight: | 466.67 |
| Molecular Formula: | C28 H42 N4 O2 |
| Salt: | not_available |
| Smiles: | CC(c1ccccc1)N(Cc1cc(ccc1N(C)C)NC(CC(C)(C)C)=O)C(NC(C)(C)C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.3493 |
| logD: | 6.3356 |
| logSw: | -5.4933 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 50.433 |
| InChI Key: | QLLRRUQAMDSDCC-FQEVSTJZSA-N |