N-{2-[3-(3,4-dimethylphenyl)-5-phenyl-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N'-ethyl-N-(2-methoxyethyl)urea
Chemical Structure Depiction of
N-{2-[3-(3,4-dimethylphenyl)-5-phenyl-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N'-ethyl-N-(2-methoxyethyl)urea
N-{2-[3-(3,4-dimethylphenyl)-5-phenyl-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N'-ethyl-N-(2-methoxyethyl)urea
Compound characteristics
| Compound ID: | V024-8982 |
| Compound Name: | N-{2-[3-(3,4-dimethylphenyl)-5-phenyl-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N'-ethyl-N-(2-methoxyethyl)urea |
| Molecular Weight: | 436.55 |
| Molecular Formula: | C25 H32 N4 O3 |
| Smiles: | CCNC(N(CCOC)CC(N1C(CC(c2ccc(C)c(C)c2)=N1)c1ccccc1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.0978 |
| logD: | 4.0978 |
| logSw: | -4.1259 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.431 |
| InChI Key: | FCRQRYNRVZLFSD-QHCPKHFHSA-N |