N-benzyl-2-chloro-N-{[5-(3,4-dimethylphenyl)-1,2-oxazol-3-yl]methyl}benzamide
Chemical Structure Depiction of
N-benzyl-2-chloro-N-{[5-(3,4-dimethylphenyl)-1,2-oxazol-3-yl]methyl}benzamide
N-benzyl-2-chloro-N-{[5-(3,4-dimethylphenyl)-1,2-oxazol-3-yl]methyl}benzamide
Compound characteristics
| Compound ID: | V024-9281 |
| Compound Name: | N-benzyl-2-chloro-N-{[5-(3,4-dimethylphenyl)-1,2-oxazol-3-yl]methyl}benzamide |
| Molecular Weight: | 430.93 |
| Molecular Formula: | C26 H23 Cl N2 O2 |
| Smiles: | Cc1ccc(cc1C)c1cc(CN(Cc2ccccc2)C(c2ccccc2[Cl])=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 6.1033 |
| logD: | 6.1033 |
| logSw: | -5.8582 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 38.208 |
| InChI Key: | UGUHWMSYWKYCFC-UHFFFAOYSA-N |