2-(4-chlorophenyl)-4-(4-fluorophenyl)-6-(4-methylpiperazin-1-yl)-2H-pyrazolo[3,4-d]pyrimidin-3-amine
Chemical Structure Depiction of
2-(4-chlorophenyl)-4-(4-fluorophenyl)-6-(4-methylpiperazin-1-yl)-2H-pyrazolo[3,4-d]pyrimidin-3-amine
2-(4-chlorophenyl)-4-(4-fluorophenyl)-6-(4-methylpiperazin-1-yl)-2H-pyrazolo[3,4-d]pyrimidin-3-amine
Compound characteristics
| Compound ID: | V025-0520 |
| Compound Name: | 2-(4-chlorophenyl)-4-(4-fluorophenyl)-6-(4-methylpiperazin-1-yl)-2H-pyrazolo[3,4-d]pyrimidin-3-amine |
| Molecular Weight: | 437.91 |
| Molecular Formula: | C22 H21 Cl F N7 |
| Salt: | not_available |
| Smiles: | CN1CCN(CC1)c1nc(c2ccc(cc2)F)c2c(n1)nn(c1ccc(cc1)[Cl])c2N |
| Stereo: | ACHIRAL |
| logP: | 4.256 |
| logD: | 3.6841 |
| logSw: | -4.634 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.298 |
| InChI Key: | DUJUBFJKPOQKQK-UHFFFAOYSA-N |