N-[(4-fluorophenyl)methyl]-5-(3-methoxybenzamido)-2-[4-(4-methoxybenzoyl)-1,4-diazepan-1-yl]benzamide
Chemical Structure Depiction of
N-[(4-fluorophenyl)methyl]-5-(3-methoxybenzamido)-2-[4-(4-methoxybenzoyl)-1,4-diazepan-1-yl]benzamide
N-[(4-fluorophenyl)methyl]-5-(3-methoxybenzamido)-2-[4-(4-methoxybenzoyl)-1,4-diazepan-1-yl]benzamide
Compound characteristics
| Compound ID: | V025-0819 |
| Compound Name: | N-[(4-fluorophenyl)methyl]-5-(3-methoxybenzamido)-2-[4-(4-methoxybenzoyl)-1,4-diazepan-1-yl]benzamide |
| Molecular Weight: | 610.69 |
| Molecular Formula: | C35 H35 F N4 O5 |
| Salt: | not_available |
| Smiles: | COc1ccc(cc1)C(N1CCCN(CC1)c1ccc(cc1C(NCc1ccc(cc1)F)=O)NC(c1cccc(c1)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1922 |
| logD: | 5.192 |
| logSw: | -5.0043 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 82.769 |
| InChI Key: | YSJJISROLCPXCP-UHFFFAOYSA-N |