5-{[(cyclobutanecarbonyl)(2-methoxyethyl)amino]methyl}-2-methoxyphenyl 4-methoxybenzene-1-sulfonate
Chemical Structure Depiction of
5-{[(cyclobutanecarbonyl)(2-methoxyethyl)amino]methyl}-2-methoxyphenyl 4-methoxybenzene-1-sulfonate
5-{[(cyclobutanecarbonyl)(2-methoxyethyl)amino]methyl}-2-methoxyphenyl 4-methoxybenzene-1-sulfonate
Compound characteristics
| Compound ID: | V025-1760 |
| Compound Name: | 5-{[(cyclobutanecarbonyl)(2-methoxyethyl)amino]methyl}-2-methoxyphenyl 4-methoxybenzene-1-sulfonate |
| Molecular Weight: | 463.55 |
| Molecular Formula: | C23 H29 N O7 S |
| Smiles: | COCCN(Cc1ccc(c(c1)OS(c1ccc(cc1)OC)(=O)=O)OC)C(C1CCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5866 |
| logD: | 2.5866 |
| logSw: | -2.939 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 76.316 |
| InChI Key: | LTLKREBVFGHABH-UHFFFAOYSA-N |