2-bromo-N-[2-(2-methoxyphenyl)ethyl]-4-[(4-methylphenyl)methyl]-4H-thieno[3,2-b]pyrrole-5-carboxamide
Chemical Structure Depiction of
2-bromo-N-[2-(2-methoxyphenyl)ethyl]-4-[(4-methylphenyl)methyl]-4H-thieno[3,2-b]pyrrole-5-carboxamide
2-bromo-N-[2-(2-methoxyphenyl)ethyl]-4-[(4-methylphenyl)methyl]-4H-thieno[3,2-b]pyrrole-5-carboxamide
Compound characteristics
| Compound ID: | V025-1916 |
| Compound Name: | 2-bromo-N-[2-(2-methoxyphenyl)ethyl]-4-[(4-methylphenyl)methyl]-4H-thieno[3,2-b]pyrrole-5-carboxamide |
| Molecular Weight: | 483.43 |
| Molecular Formula: | C24 H23 Br N2 O2 S |
| Smiles: | Cc1ccc(Cn2c(cc3c2cc(s3)[Br])C(NCCc2ccccc2OC)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 6.1192 |
| logD: | 6.1192 |
| logSw: | -5.381 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.596 |
| InChI Key: | JUNVZRDXJJYTGH-UHFFFAOYSA-N |