N-{[2-(dimethylamino)-5-(2-methoxyacetamido)phenyl]methyl}-2-phenyl-N-propylbutanamide
Chemical Structure Depiction of
N-{[2-(dimethylamino)-5-(2-methoxyacetamido)phenyl]methyl}-2-phenyl-N-propylbutanamide
N-{[2-(dimethylamino)-5-(2-methoxyacetamido)phenyl]methyl}-2-phenyl-N-propylbutanamide
Compound characteristics
| Compound ID: | V025-2991 |
| Compound Name: | N-{[2-(dimethylamino)-5-(2-methoxyacetamido)phenyl]methyl}-2-phenyl-N-propylbutanamide |
| Molecular Weight: | 425.57 |
| Molecular Formula: | C25 H35 N3 O3 |
| Salt: | not_available |
| Smiles: | CCCN(Cc1cc(ccc1N(C)C)NC(COC)=O)C(C(CC)c1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3726 |
| logD: | 4.3706 |
| logSw: | -4.2762 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.505 |
| InChI Key: | AFOQMJYXJWMMPE-JOCHJYFZSA-N |