{1-[(3,4-difluorophenyl)methyl]-3,4,5-trimethyl-1H-pyrrol-2-yl}[4-(2-fluorophenyl)piperazin-1-yl]methanone
Chemical Structure Depiction of
{1-[(3,4-difluorophenyl)methyl]-3,4,5-trimethyl-1H-pyrrol-2-yl}[4-(2-fluorophenyl)piperazin-1-yl]methanone
{1-[(3,4-difluorophenyl)methyl]-3,4,5-trimethyl-1H-pyrrol-2-yl}[4-(2-fluorophenyl)piperazin-1-yl]methanone
Compound characteristics
| Compound ID: | V025-4480 |
| Compound Name: | {1-[(3,4-difluorophenyl)methyl]-3,4,5-trimethyl-1H-pyrrol-2-yl}[4-(2-fluorophenyl)piperazin-1-yl]methanone |
| Molecular Weight: | 441.5 |
| Molecular Formula: | C25 H26 F3 N3 O |
| Smiles: | Cc1c(C)c(C(N2CCN(CC2)c2ccccc2F)=O)n(Cc2ccc(c(c2)F)F)c1C |
| Stereo: | ACHIRAL |
| logP: | 5.0521 |
| logD: | 5.0521 |
| logSw: | -4.7142 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 20.573 |
| InChI Key: | ZXVLNAZLCUFMEP-UHFFFAOYSA-N |