2-(2-benzyl-5,6-dichloro-1H-benzimidazol-1-yl)-1-(4-ethylpiperazin-1-yl)butan-1-one
Chemical Structure Depiction of
2-(2-benzyl-5,6-dichloro-1H-benzimidazol-1-yl)-1-(4-ethylpiperazin-1-yl)butan-1-one
2-(2-benzyl-5,6-dichloro-1H-benzimidazol-1-yl)-1-(4-ethylpiperazin-1-yl)butan-1-one
Compound characteristics
| Compound ID: | V025-4544 |
| Compound Name: | 2-(2-benzyl-5,6-dichloro-1H-benzimidazol-1-yl)-1-(4-ethylpiperazin-1-yl)butan-1-one |
| Molecular Weight: | 459.42 |
| Molecular Formula: | C24 H28 Cl2 N4 O |
| Salt: | not_available |
| Smiles: | CCC(C(N1CCN(CC)CC1)=O)n1c2cc(c(cc2nc1Cc1ccccc1)[Cl])[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.0913 |
| logD: | 4.8354 |
| logSw: | -5.4312 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.6085 |
| InChI Key: | LAAYNDLOTNYECS-NRFANRHFSA-N |