N-{2-[5-(2,5-dimethoxyphenyl)-3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-(2-methoxyethyl)-N'-(2-methoxyphenyl)urea
Chemical Structure Depiction of
N-{2-[5-(2,5-dimethoxyphenyl)-3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-(2-methoxyethyl)-N'-(2-methoxyphenyl)urea
N-{2-[5-(2,5-dimethoxyphenyl)-3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-(2-methoxyethyl)-N'-(2-methoxyphenyl)urea
Compound characteristics
| Compound ID: | V025-5016 |
| Compound Name: | N-{2-[5-(2,5-dimethoxyphenyl)-3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-(2-methoxyethyl)-N'-(2-methoxyphenyl)urea |
| Molecular Weight: | 564.61 |
| Molecular Formula: | C30 H33 F N4 O6 |
| Smiles: | COCCN(CC(N1C(CC(c2ccccc2F)=N1)c1cc(ccc1OC)OC)=O)C(Nc1ccccc1OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7684 |
| logD: | 4.7684 |
| logSw: | -4.4932 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 82.318 |
| InChI Key: | AJRJCUYITDOGDD-AREMUKBSSA-N |